C26H24N2O4 — CID 127253767
2-(3,5-dimethyl-7-oxofuro[3,2-g]chromen-6-yl)-N-[2-(1-methylindol-3-yl)ethyl]acetamide (PubChem CID 127253767) has the molecular formula C26H24N2O4 and a molecular weight of 428.49 g/mol. Its IUPAC name is 2-(3,5-dimethyl-7-oxofuro[3,2-g]chromen-6-yl)-N-[2-(1-methylindol-3-yl)ethyl]acetamide.
| Compound Name | 2-(3,5-dimethyl-7-oxofuro[3,2-g]chromen-6-yl)-N-[2-(1-methylindol-3-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 127253767 |
| Molecular Formula | C26H24N2O4 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | 2-(3,5-dimethyl-7-oxofuro[3,2-g]chromen-6-yl)-N-[2-(1-methylindol-3-yl)ethyl]acetamide |
| SMILES | Cc1coc2cc3oc(=O)c(CC(=O)NCCc4cn(C)c5ccccc45)c(C)c3cc12 |
| InChI | InChI=1S/C26H24N2O4/c1-15-14-31-23-12-24-20(10-19(15)23)16(2)21(26(30)32-24)11-25(29)27-9-8-17-13-28(3)22-7-5-4-6-18(17)22/h4-7,10,12-14H,8-9,11H2,1-3H3,(H,27,29) |
| InChIKey | CFUHXDFRLQDURE-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|