C19H27NO4 — CID 127254173
ethyl (1R)-4a-hydroxy-1-(4-methoxyphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinoline-2-carboxylate (PubChem CID 127254173) has the molecular formula C19H27NO4 and a molecular weight of 333.43 g/mol. Its IUPAC name is ethyl (1R)-4a-hydroxy-1-(4-methoxyphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinoline-2-carboxylate.
| Compound Name | ethyl (1R)-4a-hydroxy-1-(4-methoxyphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 127254173 |
| Molecular Formula | C19H27NO4 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | ethyl (1R)-4a-hydroxy-1-(4-methoxyphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinoline-2-carboxylate |
| SMILES | CCOC(=O)N1CCC2(O)CCCCC2[C@@H]1c1ccc(OC)cc1 |
| InChI | InChI=1S/C19H27NO4/c1-3-24-18(21)20-13-12-19(22)11-5-4-6-16(19)17(20)14-7-9-15(23-2)10-8-14/h7-10,16-17,22H,3-6,11-13H2,1-2H3/t16?,17-,19?/m0/s1 |
| InChIKey | IKACVUUEOWOOPQ-HFCFLWKCSA-N |
| XLogP | 3.52 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |