C19H16N4O4 — CID 127254318
1,3-dimethyl-5-(5-naphthalen-2-yl-2-oxo-1,3-dihydroimidazol-4-yl)-1,3-diazinane-2,4,6-trione (PubChem CID 127254318) has the molecular formula C19H16N4O4 and a molecular weight of 364.36 g/mol. Its IUPAC name is 1,3-dimethyl-5-(5-naphthalen-2-yl-2-oxo-1,3-dihydroimidazol-4-yl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 1,3-dimethyl-5-(5-naphthalen-2-yl-2-oxo-1,3-dihydroimidazol-4-yl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 127254318 |
| Molecular Formula | C19H16N4O4 |
| Molecular Weight | 364.36 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | 1,3-dimethyl-5-(5-naphthalen-2-yl-2-oxo-1,3-dihydroimidazol-4-yl)-1,3-diazinane-2,4,6-trione |
| SMILES | CN1C(=O)C(c2[nH]c(=O)[nH]c2-c2ccc3ccccc3c2)C(=O)N(C)C1=O |
| InChI | InChI=1S/C19H16N4O4/c1-22-16(24)13(17(25)23(2)19(22)27)15-14(20-18(26)21-15)12-8-7-10-5-3-4-6-11(10)9-12/h3-9,13H,1-2H3,(H2,20,21,26) |
| InChIKey | WIWXARQMSUYHAF-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.36 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|