C16H20F3N5O — CID 127254460
6-pyrrol-1-yl-1-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]hexan-1-one (PubChem CID 127254460) has the molecular formula C16H20F3N5O and a molecular weight of 355.36 g/mol. Its IUPAC name is 6-pyrrol-1-yl-1-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]hexan-1-one.
| Compound Name | 6-pyrrol-1-yl-1-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]hexan-1-one |
|---|---|
| PubChem CID | 127254460 |
| Molecular Formula | C16H20F3N5O |
| Molecular Weight | 355.36 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | 6-pyrrol-1-yl-1-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]hexan-1-one |
| SMILES | O=C(CCCCCn1cccc1)N1CCn2c(nnc2C(F)(F)F)C1 |
| InChI | InChI=1S/C16H20F3N5O/c17-16(18,19)15-21-20-13-12-23(10-11-24(13)15)14(25)6-2-1-3-7-22-8-4-5-9-22/h4-5,8-9H,1-3,6-7,10-12H2 |
| InChIKey | CNFJHLTYWWLLOH-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 55.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.36 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|