C24H22ClFN4O4 — CID 127254643
10-[3-[3-(2-chloro-6-fluorophenyl)-1,2,4-oxadiazol-5-yl]propyl]-9-methyl-11-oxo-8-oxa-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene-12-carboxamide (PubChem CID 127254643) has the molecular formula C24H22ClFN4O4 and a molecular weight of 484.92 g/mol. Its IUPAC name is 10-[3-[3-(2-chloro-6-fluorophenyl)-1,2,4-oxadiazol-5-yl]propyl]-9-methyl-11-oxo-8-oxa-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene-12-carboxamide.
| Compound Name | 10-[3-[3-(2-chloro-6-fluorophenyl)-1,2,4-oxadiazol-5-yl]propyl]-9-methyl-11-oxo-8-oxa-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene-12-carboxamide |
|---|---|
| PubChem CID | 127254643 |
| Molecular Formula | C24H22ClFN4O4 |
| Molecular Weight | 484.92 g/mol |
| Exact Mass | 484.13 |
| IUPAC Name | 10-[3-[3-(2-chloro-6-fluorophenyl)-1,2,4-oxadiazol-5-yl]propyl]-9-methyl-11-oxo-8-oxa-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene-12-carboxamide |
| SMILES | CC12CC(c3ccccc3O1)C(C(N)=O)C(=O)N2CCCc1nc(-c2c(F)cccc2Cl)no1 |
| InChI | InChI=1S/C24H22ClFN4O4/c1-24-12-14(13-6-2-3-9-17(13)33-24)19(21(27)31)23(32)30(24)11-5-10-18-28-22(29-34-18)20-15(25)7-4-8-16(20)26/h2-4,6-9,14,19H,5,10-12H2,1H3,(H2,27,31) |
| InChIKey | RGWSBAKNPLQMGT-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 111.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.92 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|