C21H27N5O — CID 127254735
6-pyrrol-1-yl-1-[4-([1,2,4]triazolo[4,3-a]pyridin-3-yl)piperidin-1-yl]hexan-1-one (PubChem CID 127254735) has the molecular formula C21H27N5O and a molecular weight of 365.48 g/mol. Its IUPAC name is 6-pyrrol-1-yl-1-[4-([1,2,4]triazolo[4,3-a]pyridin-3-yl)piperidin-1-yl]hexan-1-one.
| Compound Name | 6-pyrrol-1-yl-1-[4-([1,2,4]triazolo[4,3-a]pyridin-3-yl)piperidin-1-yl]hexan-1-one |
|---|---|
| PubChem CID | 127254735 |
| Molecular Formula | C21H27N5O |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.22 |
| IUPAC Name | 6-pyrrol-1-yl-1-[4-([1,2,4]triazolo[4,3-a]pyridin-3-yl)piperidin-1-yl]hexan-1-one |
| SMILES | O=C(CCCCCn1cccc1)N1CCC(c2nnc3ccccn23)CC1 |
| InChI | InChI=1S/C21H27N5O/c27-20(9-2-1-4-12-24-13-6-7-14-24)25-16-10-18(11-17-25)21-23-22-19-8-3-5-15-26(19)21/h3,5-8,13-15,18H,1-2,4,9-12,16-17H2 |
| InChIKey | QWNPMRCHAMWLFD-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 55.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|