C22H17F3N4O2 — CID 127254881
1-[(S)-1H-benzimidazol-2-yl(phenyl)methyl]-3-[4-(trifluoromethoxy)phenyl]urea (PubChem CID 127254881) has the molecular formula C22H17F3N4O2 and a molecular weight of 426.40 g/mol. Its IUPAC name is 1-[(S)-1H-benzimidazol-2-yl(phenyl)methyl]-3-[4-(trifluoromethoxy)phenyl]urea.
| Compound Name | 1-[(S)-1H-benzimidazol-2-yl(phenyl)methyl]-3-[4-(trifluoromethoxy)phenyl]urea |
|---|---|
| PubChem CID | 127254881 |
| Molecular Formula | C22H17F3N4O2 |
| Molecular Weight | 426.40 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | 1-[(S)-1H-benzimidazol-2-yl(phenyl)methyl]-3-[4-(trifluoromethoxy)phenyl]urea |
| SMILES | O=C(Nc1ccc(OC(F)(F)F)cc1)N[C@@H](c1ccccc1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C22H17F3N4O2/c23-22(24,25)31-16-12-10-15(11-13-16)26-21(30)29-19(14-6-2-1-3-7-14)20-27-17-8-4-5-9-18(17)28-20/h1-13,19H,(H,27,28)(H2,26,29,30)/t19-/m0/s1 |
| InChIKey | LWQPVKQXGITMBL-IBGZPJMESA-N |
| XLogP | 5.37 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.40 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |