C18H22N4O — CID 127255298
N-(2-methyl-3H-benzimidazol-5-yl)-6-pyrrol-1-ylhexanamide (PubChem CID 127255298) has the molecular formula C18H22N4O and a molecular weight of 310.40 g/mol. Its IUPAC name is N-(2-methyl-3H-benzimidazol-5-yl)-6-pyrrol-1-ylhexanamide.
| Compound Name | N-(2-methyl-3H-benzimidazol-5-yl)-6-pyrrol-1-ylhexanamide |
|---|---|
| PubChem CID | 127255298 |
| Molecular Formula | C18H22N4O |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | N-(2-methyl-3H-benzimidazol-5-yl)-6-pyrrol-1-ylhexanamide |
| SMILES | Cc1nc2ccc(NC(=O)CCCCCn3cccc3)cc2[nH]1 |
| InChI | InChI=1S/C18H22N4O/c1-14-19-16-9-8-15(13-17(16)20-14)21-18(23)7-3-2-4-10-22-11-5-6-12-22/h5-6,8-9,11-13H,2-4,7,10H2,1H3,(H,19,20)(H,21,23) |
| InChIKey | HRVULHUNRSXLBX-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|