C52H60O4P2 — CID 127256133
[2-[2-bis(3,4,5-trimethylphenyl)phosphanyl-4,6-dimethoxyphenyl]-3,5-dimethoxyphenyl]-bis(3,4,5-trimethylphenyl)phosphane (PubChem CID 127256133) has the molecular formula C52H60O4P2 and a molecular weight of 811.00 g/mol. Its IUPAC name is [2-[2-bis(3,4,5-trimethylphenyl)phosphanyl-4,6-dimethoxyphenyl]-3,5-dimethoxyphenyl]-bis(3,4,5-trimethylphenyl)phosphane.
| Compound Name | [2-[2-bis(3,4,5-trimethylphenyl)phosphanyl-4,6-dimethoxyphenyl]-3,5-dimethoxyphenyl]-bis(3,4,5-trimethylphenyl)phosphane |
|---|---|
| PubChem CID | 127256133 |
| Molecular Formula | C52H60O4P2 |
| Molecular Weight | 811.00 g/mol |
| Exact Mass | 810.40 |
| IUPAC Name | [2-[2-bis(3,4,5-trimethylphenyl)phosphanyl-4,6-dimethoxyphenyl]-3,5-dimethoxyphenyl]-bis(3,4,5-trimethylphenyl)phosphane |
| SMILES | COc1cc(OC)c(-c2c(OC)cc(OC)cc2P(c2cc(C)c(C)c(C)c2)c2cc(C)c(C)c(C)c2)c(P(c2cc(C)c(C)c(C)c2)c2cc(C)c(C)c(C)c2)c1 |
| InChI | InChI=1S/C52H60O4P2/c1-29-17-43(18-30(2)37(29)9)57(44-19-31(3)38(10)32(4)20-44)49-27-41(53-13)25-47(55-15)51(49)52-48(56-16)26-42(54-14)28-50(52)58(45-21-33(5)39(11)34(6)22-45)46-23-35(7)40(12)36(8)24-46/h17-28H,1-16H3 |
| InChIKey | ITFRFVKFGZCSKA-UHFFFAOYSA-N |
| XLogP | 10.61 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 811.00 |
| LogP ≤ 5 | 10.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|