About 8-(diethylaminomethyl)-6,7-dihydroxychromen-2-one;hydrochloride
8-(diethylaminomethyl)-6,7-dihydroxychromen-2-one;hydrochloride (PubChem CID 127256407) has the molecular formula C14H18ClNO4
and a molecular weight of 299.75 g/mol. Its IUPAC name is 8-(diethylaminomethyl)-6,7-dihydroxychromen-2-one;hydrochloride.
Molecular Properties
| Compound Name | 8-(diethylaminomethyl)-6,7-dihydroxychromen-2-one;hydrochloride |
| PubChem CID | 127256407 |
| Molecular Formula | C14H18ClNO4 |
| Molecular Weight | 299.75 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | 8-(diethylaminomethyl)-6,7-dihydroxychromen-2-one;hydrochloride |
| SMILES | CCN(CC)Cc1c(O)c(O)cc2ccc(=O)oc12.Cl |
| InChI | InChI=1S/C14H17NO4.ClH/c1-3-15(4-2)8-10-13(18)11(16)7-9-5-6-12(17)19-14(9)10;/h5-7,16,18H,3-4,8H2,1-2H3;1H |
| InChIKey | DXLWTPHMNSEGGI-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.75 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 8-(diethylaminomethyl)-6,7-dihydroxychromen-2-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(diethylaminomethyl)-6,7-dihydroxychromen-2-one;hydrochloride?
The IUPAC name of 8-(diethylaminomethyl)-6,7-dihydroxychromen-2-one;hydrochloride (CID 127256407) is 8-(diethylaminomethyl)-6,7-dihydroxychromen-2-one;hydrochloride.
What is the SMILES notation for 8-(diethylaminomethyl)-6,7-dihydroxychromen-2-one;hydrochloride?
The canonical SMILES for 8-(diethylaminomethyl)-6,7-dihydroxychromen-2-one;hydrochloride is CCN(CC)Cc1c(O)c(O)cc2ccc(=O)oc12.Cl.
What is the InChIKey of 8-(diethylaminomethyl)-6,7-dihydroxychromen-2-one;hydrochloride?
The InChIKey is DXLWTPHMNSEGGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17NO4.ClH/c1-3-15(4-2)8-10-13(18)11(16)7-9-5-6-12(17)19-14(9)10;/h5-7,16,18H,3-4,8H2,1-2H3;1H.
What are the key properties of 8-(diethylaminomethyl)-6,7-dihydroxychromen-2-one;hydrochloride?
8-(diethylaminomethyl)-6,7-dihydroxychromen-2-one;hydrochloride has a molecular weight of 299.75 g/mol, XLogP of 2.47, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(diethylaminomethyl)-6,7-dihydroxychromen-2-one;hydrochloride is sourced from PubChem (CID 127256407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).