About pyrrole-2,2-dicarbaldehyde
pyrrole-2,2-dicarbaldehyde (PubChem CID 127256682) has the molecular formula C6H5NO2
and a molecular weight of 123.11 g/mol. Its IUPAC name is pyrrole-2,2-dicarbaldehyde.
Molecular Properties
| Compound Name | pyrrole-2,2-dicarbaldehyde |
| PubChem CID | 127256682 |
| Molecular Formula | C6H5NO2 |
| Molecular Weight | 123.11 g/mol |
| Exact Mass | 123.03 |
| IUPAC Name | pyrrole-2,2-dicarbaldehyde |
| SMILES | O=CC1(C=O)C=CC=N1 |
| InChI | InChI=1S/C6H5NO2/c8-4-6(5-9)2-1-3-7-6/h1-5H |
| InChIKey | DAEQKMXDUZDXNJ-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.11 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze pyrrole-2,2-dicarbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrrole-2,2-dicarbaldehyde?
The IUPAC name of pyrrole-2,2-dicarbaldehyde (CID 127256682) is pyrrole-2,2-dicarbaldehyde.
What is the SMILES notation for pyrrole-2,2-dicarbaldehyde?
The canonical SMILES for pyrrole-2,2-dicarbaldehyde is O=CC1(C=O)C=CC=N1.
What is the InChIKey of pyrrole-2,2-dicarbaldehyde?
The InChIKey is DAEQKMXDUZDXNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5NO2/c8-4-6(5-9)2-1-3-7-6/h1-5H.
What are the key properties of pyrrole-2,2-dicarbaldehyde?
pyrrole-2,2-dicarbaldehyde has a molecular weight of 123.11 g/mol, XLogP of -0.24, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pyrrole-2,2-dicarbaldehyde is sourced from PubChem (CID 127256682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).