C15H9ClO2 — CID 127256784
(2E)-2-[(3-chlorophenyl)methylidene]-1-benzofuran-3-one (PubChem CID 127256784) has the molecular formula C15H9ClO2 and a molecular weight of 256.69 g/mol. Its IUPAC name is (2E)-2-[(3-chlorophenyl)methylidene]-1-benzofuran-3-one.
| Compound Name | (2E)-2-[(3-chlorophenyl)methylidene]-1-benzofuran-3-one |
|---|---|
| PubChem CID | 127256784 |
| Molecular Formula | C15H9ClO2 |
| Molecular Weight | 256.69 g/mol |
| Exact Mass | 256.03 |
| IUPAC Name | (2E)-2-[(3-chlorophenyl)methylidene]-1-benzofuran-3-one |
| SMILES | O=C1/C(=C\c2cccc(Cl)c2)Oc2ccccc21 |
| InChI | InChI=1S/C15H9ClO2/c16-11-5-3-4-10(8-11)9-14-15(17)12-6-1-2-7-13(12)18-14/h1-9H/b14-9+ |
| InChIKey | CCFUFYQPADLXAW-NTEUORMPSA-N |
| XLogP | 3.96 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.69 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|