C22H42N4O2 — CID 1272586
4-(4-amino-2,2,6,6-tetramethylpiperidin-1-yl)-4-oxo-N-(2,2,6,6-tetramethylpiperidin-4-yl)butanamide (PubChem CID 1272586) has the molecular formula C22H42N4O2 and a molecular weight of 394.60 g/mol. Its IUPAC name is 4-(4-amino-2,2,6,6-tetramethylpiperidin-1-yl)-4-oxo-N-(2,2,6,6-tetramethylpiperidin-4-yl)butanamide.
| Compound Name | 4-(4-amino-2,2,6,6-tetramethylpiperidin-1-yl)-4-oxo-N-(2,2,6,6-tetramethylpiperidin-4-yl)butanamide |
|---|---|
| PubChem CID | 1272586 |
| Molecular Formula | C22H42N4O2 |
| Molecular Weight | 394.60 g/mol |
| Exact Mass | 394.33 |
| IUPAC Name | 4-(4-amino-2,2,6,6-tetramethylpiperidin-1-yl)-4-oxo-N-(2,2,6,6-tetramethylpiperidin-4-yl)butanamide |
| SMILES | CC1(C)CC(NC(=O)CCC(=O)N2C(C)(C)CC(N)CC2(C)C)CC(C)(C)N1 |
| InChI | InChI=1S/C22H42N4O2/c1-19(2)13-16(14-20(3,4)25-19)24-17(27)9-10-18(28)26-21(5,6)11-15(23)12-22(26,7)8/h15-16,25H,9-14,23H2,1-8H3,(H,24,27) |
| InChIKey | WWKRSTPMXKDAEB-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.60 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |