C12H21BCl2N2O2 — CID 127258909
[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]methanamine;dihydrochloride (PubChem CID 127258909) has the molecular formula C12H21BCl2N2O2 and a molecular weight of 307.03 g/mol. Its IUPAC name is [5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]methanamine;dihydrochloride.
| Compound Name | [5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]methanamine;dihydrochloride |
|---|---|
| PubChem CID | 127258909 |
| Molecular Formula | C12H21BCl2N2O2 |
| Molecular Weight | 307.03 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | [5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]methanamine;dihydrochloride |
| SMILES | CC1(C)OB(c2ccc(CN)nc2)OC1(C)C.Cl.Cl |
| InChI | InChI=1S/C12H19BN2O2.2ClH/c1-11(2)12(3,4)17-13(16-11)9-5-6-10(7-14)15-8-9;;/h5-6,8H,7,14H2,1-4H3;2*1H |
| InChIKey | DSJYVJJFNLAXHU-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.03 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|