About 1-butyl-3-propylthiourea
1-butyl-3-propylthiourea (PubChem CID 12725926) has the molecular formula C8H18N2S
and a molecular weight of 174.31 g/mol. Its IUPAC name is 1-butyl-3-propylthiourea.
Molecular Properties
| Compound Name | 1-butyl-3-propylthiourea |
| PubChem CID | 12725926 |
| Molecular Formula | C8H18N2S |
| Molecular Weight | 174.31 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | 1-butyl-3-propylthiourea |
| SMILES | CCCCNC(=S)NCCC |
| InChI | InChI=1S/C8H18N2S/c1-3-5-7-10-8(11)9-6-4-2/h3-7H2,1-2H3,(H2,9,10,11) |
| InChIKey | JYKYHGRCCOXICX-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.31 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-butyl-3-propylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-3-propylthiourea?
The IUPAC name of 1-butyl-3-propylthiourea (CID 12725926) is 1-butyl-3-propylthiourea.
What is the SMILES notation for 1-butyl-3-propylthiourea?
The canonical SMILES for 1-butyl-3-propylthiourea is CCCCNC(=S)NCCC.
What is the InChIKey of 1-butyl-3-propylthiourea?
The InChIKey is JYKYHGRCCOXICX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N2S/c1-3-5-7-10-8(11)9-6-4-2/h3-7H2,1-2H3,(H2,9,10,11).
What are the key properties of 1-butyl-3-propylthiourea?
1-butyl-3-propylthiourea has a molecular weight of 174.31 g/mol, XLogP of 1.66, 5 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-3-propylthiourea is sourced from PubChem (CID 12725926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).