C20H24OSi — CID 127260673
trans-(3R,5S)-3-[dimethyl(phenyl)silyl]-5-phenylcyclohexan-1-one (PubChem CID 127260673) has the molecular formula C20H24OSi and a molecular weight of 308.50 g/mol. Its IUPAC name is trans-(3R,5S)-3-[dimethyl(phenyl)silyl]-5-phenylcyclohexan-1-one.
| Compound Name | trans-(3R,5S)-3-[dimethyl(phenyl)silyl]-5-phenylcyclohexan-1-one |
|---|---|
| PubChem CID | 127260673 |
| Molecular Formula | C20H24OSi |
| Molecular Weight | 308.50 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | trans-(3R,5S)-3-[dimethyl(phenyl)silyl]-5-phenylcyclohexan-1-one |
| SMILES | C[Si](C)(c1ccccc1)[C@H]1CC(=O)C[C@H](c2ccccc2)C1 |
| InChI | InChI=1S/C20H24OSi/c1-22(2,19-11-7-4-8-12-19)20-14-17(13-18(21)15-20)16-9-5-3-6-10-16/h3-12,17,20H,13-15H2,1-2H3/t17-,20+/m0/s1 |
| InChIKey | WEEKMMFADOURAJ-FXAWDEMLSA-N |
| XLogP | 4.51 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.50 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|