About 4-ethylpyrazolo[1,5-a]pyrimidine-7-thione
4-ethylpyrazolo[1,5-a]pyrimidine-7-thione (PubChem CID 12726142) has the molecular formula C8H9N3S
and a molecular weight of 179.25 g/mol. Its IUPAC name is 4-ethylpyrazolo[1,5-a]pyrimidine-7-thione.
Molecular Properties
| Compound Name | 4-ethylpyrazolo[1,5-a]pyrimidine-7-thione |
| PubChem CID | 12726142 |
| Molecular Formula | C8H9N3S |
| Molecular Weight | 179.25 g/mol |
| Exact Mass | 179.05 |
| IUPAC Name | 4-ethylpyrazolo[1,5-a]pyrimidine-7-thione |
| SMILES | CCn1ccc(=S)n2nccc12 |
| InChI | InChI=1S/C8H9N3S/c1-2-10-6-4-8(12)11-7(10)3-5-9-11/h3-6H,2H2,1H3 |
| InChIKey | BAYWPLPFTCCVGI-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 22.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.25 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-ethylpyrazolo[1,5-a]pyrimidine-7-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethylpyrazolo[1,5-a]pyrimidine-7-thione?
The IUPAC name of 4-ethylpyrazolo[1,5-a]pyrimidine-7-thione (CID 12726142) is 4-ethylpyrazolo[1,5-a]pyrimidine-7-thione.
What is the SMILES notation for 4-ethylpyrazolo[1,5-a]pyrimidine-7-thione?
The canonical SMILES for 4-ethylpyrazolo[1,5-a]pyrimidine-7-thione is CCn1ccc(=S)n2nccc12.
What is the InChIKey of 4-ethylpyrazolo[1,5-a]pyrimidine-7-thione?
The InChIKey is BAYWPLPFTCCVGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3S/c1-2-10-6-4-8(12)11-7(10)3-5-9-11/h3-6H,2H2,1H3.
What are the key properties of 4-ethylpyrazolo[1,5-a]pyrimidine-7-thione?
4-ethylpyrazolo[1,5-a]pyrimidine-7-thione has a molecular weight of 179.25 g/mol, XLogP of 1.89, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethylpyrazolo[1,5-a]pyrimidine-7-thione is sourced from PubChem (CID 12726142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).