C11H4F11NO — CID 12726242
1-[1,1,1,4,4,5,5,5-octafluoro-2-(trifluoromethyl)pent-2-en-3-yl]pyridin-2-one (PubChem CID 12726242) has the molecular formula C11H4F11NO and a molecular weight of 375.14 g/mol. Its IUPAC name is 1-[1,1,1,4,4,5,5,5-octafluoro-2-(trifluoromethyl)pent-2-en-3-yl]pyridin-2-one.
| Compound Name | 1-[1,1,1,4,4,5,5,5-octafluoro-2-(trifluoromethyl)pent-2-en-3-yl]pyridin-2-one |
|---|---|
| PubChem CID | 12726242 |
| Molecular Formula | C11H4F11NO |
| Molecular Weight | 375.14 g/mol |
| Exact Mass | 375.01 |
| IUPAC Name | 1-[1,1,1,4,4,5,5,5-octafluoro-2-(trifluoromethyl)pent-2-en-3-yl]pyridin-2-one |
| SMILES | O=c1ccccn1C(=C(C(F)(F)F)C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H4F11NO/c12-8(13,11(20,21)22)7(23-4-2-1-3-5(23)24)6(9(14,15)16)10(17,18)19/h1-4H |
| InChIKey | MWKHSZPKOHPKIW-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.14 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|