C15H23BO4S — CID 127262602
4,4,5,5-tetramethyl-2-(2-propan-2-ylsulfonylphenyl)-1,3,2-dioxaborolane (PubChem CID 127262602) has the molecular formula C15H23BO4S and a molecular weight of 310.22 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-(2-propan-2-ylsulfonylphenyl)-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-(2-propan-2-ylsulfonylphenyl)-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 127262602 |
| Molecular Formula | C15H23BO4S |
| Molecular Weight | 310.22 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-(2-propan-2-ylsulfonylphenyl)-1,3,2-dioxaborolane |
| SMILES | CC(C)S(=O)(=O)c1ccccc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C15H23BO4S/c1-11(2)21(17,18)13-10-8-7-9-12(13)16-19-14(3,4)15(5,6)20-16/h7-11H,1-6H3 |
| InChIKey | LPRASZJJWLDDRP-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.22 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|