C17H18N7NaO2 — CID 127262618
sodium 7-[(1,5-dimethylpyrazol-3-yl)amino]-10-ethyl-3-methyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene-11-carboxylate (PubChem CID 127262618) has the molecular formula C17H18N7NaO2 and a molecular weight of 375.37 g/mol. Its IUPAC name is sodium 7-[(1,5-dimethylpyrazol-3-yl)amino]-10-ethyl-3-methyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene-11-carboxylate.
| Compound Name | sodium 7-[(1,5-dimethylpyrazol-3-yl)amino]-10-ethyl-3-methyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene-11-carboxylate |
|---|---|
| PubChem CID | 127262618 |
| Molecular Formula | C17H18N7NaO2 |
| Molecular Weight | 375.37 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | sodium 7-[(1,5-dimethylpyrazol-3-yl)amino]-10-ethyl-3-methyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene-11-carboxylate |
| SMILES | CCn1c(C(=O)[O-])cc2c3c(ncn3C)c(Nc3cc(C)n(C)n3)nc21.[Na+] |
| InChI | InChI=1S/C17H19N7O2.Na/c1-5-24-11(17(25)26)7-10-14-13(18-8-22(14)3)15(20-16(10)24)19-12-6-9(2)23(4)21-12;/h6-8H,5H2,1-4H3,(H,25,26)(H,19,20,21);/q;+1/p-1 |
| InChIKey | OADQHKKMHPHNSK-UHFFFAOYSA-M |
| XLogP | -1.90 |
| TPSA | 105.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.37 |
| LogP ≤ 5 | -1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |