C27H27NP+ — CID 127262754
dimethyl-[2-(N-(4-methylphenyl)anilino)phenyl]-phenylphosphanium (PubChem CID 127262754) has the molecular formula C27H27NP+ and a molecular weight of 396.49 g/mol. Its IUPAC name is dimethyl-[2-(N-(4-methylphenyl)anilino)phenyl]-phenylphosphanium.
| Compound Name | dimethyl-[2-(N-(4-methylphenyl)anilino)phenyl]-phenylphosphanium |
|---|---|
| PubChem CID | 127262754 |
| Molecular Formula | C27H27NP+ |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | dimethyl-[2-(N-(4-methylphenyl)anilino)phenyl]-phenylphosphanium |
| SMILES | Cc1ccc(N(c2ccccc2)c2ccccc2[P+](C)(C)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H27NP/c1-22-18-20-24(21-19-22)28(23-12-6-4-7-13-23)26-16-10-11-17-27(26)29(2,3)25-14-8-5-9-15-25/h4-21H,1-3H3/q+1 |
| InChIKey | LYDANRUDQBQBQN-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|