C39H62O2P2 — CID 127262821
ditert-butyl-(8'-ditert-butylphosphanyl-4,4,4',4',6,6'-hexamethyl-2,2'-spirobi[3H-chromene]-8-yl)phosphane (PubChem CID 127262821) has the molecular formula C39H62O2P2 and a molecular weight of 624.87 g/mol. Its IUPAC name is ditert-butyl-(8'-ditert-butylphosphanyl-4,4,4',4',6,6'-hexamethyl-2,2'-spirobi[3H-chromene]-8-yl)phosphane.
| Compound Name | ditert-butyl-(8'-ditert-butylphosphanyl-4,4,4',4',6,6'-hexamethyl-2,2'-spirobi[3H-chromene]-8-yl)phosphane |
|---|---|
| PubChem CID | 127262821 |
| Molecular Formula | C39H62O2P2 |
| Molecular Weight | 624.87 g/mol |
| Exact Mass | 624.42 |
| IUPAC Name | ditert-butyl-(8'-ditert-butylphosphanyl-4,4,4',4',6,6'-hexamethyl-2,2'-spirobi[3H-chromene]-8-yl)phosphane |
| SMILES | Cc1cc(P(C(C)(C)C)C(C)(C)C)c2c(c1)C(C)(C)CC1(CC(C)(C)c3cc(C)cc(P(C(C)(C)C)C(C)(C)C)c3O1)O2 |
| InChI | InChI=1S/C39H62O2P2/c1-25-19-27-31(29(21-25)42(33(3,4)5)34(6,7)8)40-39(23-37(27,15)16)24-38(17,18)28-20-26(2)22-30(32(28)41-39)43(35(9,10)11)36(12,13)14/h19-22H,23-24H2,1-18H3 |
| InChIKey | CMAMANMTJLHCKR-UHFFFAOYSA-N |
| XLogP | 11.23 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.87 |
| LogP ≤ 5 | 11.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|