About (5S)-5-(aminomethyl)-1,3-oxazolidin-2-one;hydrochloride
(5S)-5-(aminomethyl)-1,3-oxazolidin-2-one;hydrochloride (PubChem CID 127263316) has the molecular formula C4H9ClN2O2
and a molecular weight of 152.58 g/mol. Its IUPAC name is (5S)-5-(aminomethyl)-1,3-oxazolidin-2-one;hydrochloride.
Molecular Properties
| Compound Name | (5S)-5-(aminomethyl)-1,3-oxazolidin-2-one;hydrochloride |
| PubChem CID | 127263316 |
| Molecular Formula | C4H9ClN2O2 |
| Molecular Weight | 152.58 g/mol |
| Exact Mass | 152.04 |
| IUPAC Name | (5S)-5-(aminomethyl)-1,3-oxazolidin-2-one;hydrochloride |
| SMILES | Cl.NC[C@H]1CNC(=O)O1 |
| InChI | InChI=1S/C4H8N2O2.ClH/c5-1-3-2-6-4(7)8-3;/h3H,1-2,5H2,(H,6,7);1H/t3-;/m0./s1 |
| InChIKey | TWOFNQCERHOFJY-DFWYDOINSA-N |
| XLogP | -0.52 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.58 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (5S)-5-(aminomethyl)-1,3-oxazolidin-2-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-5-(aminomethyl)-1,3-oxazolidin-2-one;hydrochloride?
The IUPAC name of (5S)-5-(aminomethyl)-1,3-oxazolidin-2-one;hydrochloride (CID 127263316) is (5S)-5-(aminomethyl)-1,3-oxazolidin-2-one;hydrochloride.
What is the SMILES notation for (5S)-5-(aminomethyl)-1,3-oxazolidin-2-one;hydrochloride?
The canonical SMILES for (5S)-5-(aminomethyl)-1,3-oxazolidin-2-one;hydrochloride is Cl.NC[C@H]1CNC(=O)O1.
What is the InChIKey of (5S)-5-(aminomethyl)-1,3-oxazolidin-2-one;hydrochloride?
The InChIKey is TWOFNQCERHOFJY-DFWYDOINSA-N. The full InChI is InChI=1S/C4H8N2O2.ClH/c5-1-3-2-6-4(7)8-3;/h3H,1-2,5H2,(H,6,7);1H/t3-;/m0./s1.
What are the key properties of (5S)-5-(aminomethyl)-1,3-oxazolidin-2-one;hydrochloride?
(5S)-5-(aminomethyl)-1,3-oxazolidin-2-one;hydrochloride has a molecular weight of 152.58 g/mol, XLogP of -0.52, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-5-(aminomethyl)-1,3-oxazolidin-2-one;hydrochloride is sourced from PubChem (CID 127263316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).