C12H13FN2O2 — CID 127263481
N-[(4-fluorophenyl)methyl]-2-oxopyrrolidine-3-carboxamide (PubChem CID 127263481) has the molecular formula C12H13FN2O2 and a molecular weight of 236.25 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-2-oxopyrrolidine-3-carboxamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-2-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 127263481 |
| Molecular Formula | C12H13FN2O2 |
| Molecular Weight | 236.25 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-2-oxopyrrolidine-3-carboxamide |
| SMILES | O=C1NCCC1C(=O)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C12H13FN2O2/c13-9-3-1-8(2-4-9)7-15-12(17)10-5-6-14-11(10)16/h1-4,10H,5-7H2,(H,14,16)(H,15,17) |
| InChIKey | RSRBCLNRYRLEKS-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.25 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|