About 7-methyl-2,3-dihydrochromen-4-one;hydrochloride
7-methyl-2,3-dihydrochromen-4-one;hydrochloride (PubChem CID 127263931) has the molecular formula C10H11ClO2
and a molecular weight of 198.65 g/mol. Its IUPAC name is 7-methyl-2,3-dihydrochromen-4-one;hydrochloride.
Molecular Properties
| Compound Name | 7-methyl-2,3-dihydrochromen-4-one;hydrochloride |
| PubChem CID | 127263931 |
| Molecular Formula | C10H11ClO2 |
| Molecular Weight | 198.65 g/mol |
| Exact Mass | 198.04 |
| IUPAC Name | 7-methyl-2,3-dihydrochromen-4-one;hydrochloride |
| SMILES | Cc1ccc2c(c1)OCCC2=O.Cl |
| InChI | InChI=1S/C10H10O2.ClH/c1-7-2-3-8-9(11)4-5-12-10(8)6-7;/h2-3,6H,4-5H2,1H3;1H |
| InChIKey | UIBFTCPEXQFUFP-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.65 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-methyl-2,3-dihydrochromen-4-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-2,3-dihydrochromen-4-one;hydrochloride?
The IUPAC name of 7-methyl-2,3-dihydrochromen-4-one;hydrochloride (CID 127263931) is 7-methyl-2,3-dihydrochromen-4-one;hydrochloride.
What is the SMILES notation for 7-methyl-2,3-dihydrochromen-4-one;hydrochloride?
The canonical SMILES for 7-methyl-2,3-dihydrochromen-4-one;hydrochloride is Cc1ccc2c(c1)OCCC2=O.Cl.
What is the InChIKey of 7-methyl-2,3-dihydrochromen-4-one;hydrochloride?
The InChIKey is UIBFTCPEXQFUFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O2.ClH/c1-7-2-3-8-9(11)4-5-12-10(8)6-7;/h2-3,6H,4-5H2,1H3;1H.
What are the key properties of 7-methyl-2,3-dihydrochromen-4-one;hydrochloride?
7-methyl-2,3-dihydrochromen-4-one;hydrochloride has a molecular weight of 198.65 g/mol, XLogP of 2.38, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-2,3-dihydrochromen-4-one;hydrochloride is sourced from PubChem (CID 127263931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).