About 4-bromo-2,6-diethylpyridine;hydrochloride
4-bromo-2,6-diethylpyridine;hydrochloride (PubChem CID 127264197) has the molecular formula C9H13BrClN
and a molecular weight of 250.57 g/mol. Its IUPAC name is 4-bromo-2,6-diethylpyridine;hydrochloride.
Molecular Properties
| Compound Name | 4-bromo-2,6-diethylpyridine;hydrochloride |
| PubChem CID | 127264197 |
| Molecular Formula | C9H13BrClN |
| Molecular Weight | 250.57 g/mol |
| Exact Mass | 248.99 |
| IUPAC Name | 4-bromo-2,6-diethylpyridine;hydrochloride |
| SMILES | CCc1cc(Br)cc(CC)n1.Cl |
| InChI | InChI=1S/C9H12BrN.ClH/c1-3-8-5-7(10)6-9(4-2)11-8;/h5-6H,3-4H2,1-2H3;1H |
| InChIKey | UVHRTPNHRMQOKE-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.57 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-bromo-2,6-diethylpyridine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-2,6-diethylpyridine;hydrochloride?
The IUPAC name of 4-bromo-2,6-diethylpyridine;hydrochloride (CID 127264197) is 4-bromo-2,6-diethylpyridine;hydrochloride.
What is the SMILES notation for 4-bromo-2,6-diethylpyridine;hydrochloride?
The canonical SMILES for 4-bromo-2,6-diethylpyridine;hydrochloride is CCc1cc(Br)cc(CC)n1.Cl.
What is the InChIKey of 4-bromo-2,6-diethylpyridine;hydrochloride?
The InChIKey is UVHRTPNHRMQOKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12BrN.ClH/c1-3-8-5-7(10)6-9(4-2)11-8;/h5-6H,3-4H2,1-2H3;1H.
What are the key properties of 4-bromo-2,6-diethylpyridine;hydrochloride?
4-bromo-2,6-diethylpyridine;hydrochloride has a molecular weight of 250.57 g/mol, XLogP of 3.39, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-2,6-diethylpyridine;hydrochloride is sourced from PubChem (CID 127264197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).