About tert-butyl N-(2-methyl-1,3-oxazol-5-yl)carbamate
tert-butyl N-(2-methyl-1,3-oxazol-5-yl)carbamate (PubChem CID 127264687) has the molecular formula C9H14N2O3
and a molecular weight of 198.22 g/mol. Its IUPAC name is tert-butyl N-(2-methyl-1,3-oxazol-5-yl)carbamate.
Molecular Properties
| Compound Name | tert-butyl N-(2-methyl-1,3-oxazol-5-yl)carbamate |
| PubChem CID | 127264687 |
| Molecular Formula | C9H14N2O3 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | tert-butyl N-(2-methyl-1,3-oxazol-5-yl)carbamate |
| SMILES | Cc1ncc(NC(=O)OC(C)(C)C)o1 |
| InChI | InChI=1S/C9H14N2O3/c1-6-10-5-7(13-6)11-8(12)14-9(2,3)4/h5H,1-4H3,(H,11,12) |
| InChIKey | ZYSOXRVUVDAUCQ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl N-(2-methyl-1,3-oxazol-5-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-(2-methyl-1,3-oxazol-5-yl)carbamate?
The IUPAC name of tert-butyl N-(2-methyl-1,3-oxazol-5-yl)carbamate (CID 127264687) is tert-butyl N-(2-methyl-1,3-oxazol-5-yl)carbamate.
What is the SMILES notation for tert-butyl N-(2-methyl-1,3-oxazol-5-yl)carbamate?
The canonical SMILES for tert-butyl N-(2-methyl-1,3-oxazol-5-yl)carbamate is Cc1ncc(NC(=O)OC(C)(C)C)o1.
What is the InChIKey of tert-butyl N-(2-methyl-1,3-oxazol-5-yl)carbamate?
The InChIKey is ZYSOXRVUVDAUCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O3/c1-6-10-5-7(13-6)11-8(12)14-9(2,3)4/h5H,1-4H3,(H,11,12).
What are the key properties of tert-butyl N-(2-methyl-1,3-oxazol-5-yl)carbamate?
tert-butyl N-(2-methyl-1,3-oxazol-5-yl)carbamate has a molecular weight of 198.22 g/mol, XLogP of 2.33, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-(2-methyl-1,3-oxazol-5-yl)carbamate is sourced from PubChem (CID 127264687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).