C9H10O3 — CID 12726603
4-methyl-3a,4,5,7a-tetrahydro-2-benzofuran-1,3-dione (PubChem CID 12726603) has the molecular formula C9H10O3 and a molecular weight of 166.18 g/mol. Its IUPAC name is 4-methyl-3a,4,5,7a-tetrahydro-2-benzofuran-1,3-dione.
| Compound Name | 4-methyl-3a,4,5,7a-tetrahydro-2-benzofuran-1,3-dione |
|---|---|
| PubChem CID | 12726603 |
| Molecular Formula | C9H10O3 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.06 |
| IUPAC Name | 4-methyl-3a,4,5,7a-tetrahydro-2-benzofuran-1,3-dione |
| SMILES | CC1CC=CC2C(=O)OC(=O)C12 |
| InChI | InChI=1S/C9H10O3/c1-5-3-2-4-6-7(5)9(11)12-8(6)10/h2,4-7H,3H2,1H3 |
| InChIKey | LWMIDUUVMLBKQF-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|