About (5-fluoro-3,6-dihydro-2H-pyridin-1-yl)-(5-hydroxy-6-iodo-3-pyridinyl)methanone
(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)-(5-hydroxy-6-iodo-3-pyridinyl)methanone (PubChem CID 127266155) has the molecular formula C11H10FIN2O2
and a molecular weight of 348.12 g/mol. Its IUPAC name is (5-fluoro-3,6-dihydro-2H-pyridin-1-yl)-(5-hydroxy-6-iodo-3-pyridinyl)methanone.
Molecular Properties
| Compound Name | (5-fluoro-3,6-dihydro-2H-pyridin-1-yl)-(5-hydroxy-6-iodo-3-pyridinyl)methanone |
| PubChem CID | 127266155 |
| Molecular Formula | C11H10FIN2O2 |
| Molecular Weight | 348.12 g/mol |
| Exact Mass | 347.98 |
| IUPAC Name | (5-fluoro-3,6-dihydro-2H-pyridin-1-yl)-(5-hydroxy-6-iodo-3-pyridinyl)methanone |
| SMILES | O=C(c1cnc(I)c(O)c1)N1CCC=C(F)C1 |
| InChI | InChI=1S/C11H10FIN2O2/c12-8-2-1-3-15(6-8)11(17)7-4-9(16)10(13)14-5-7/h2,4-5,16H,1,3,6H2 |
| InChIKey | GIVUQAXASVAYIZ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.12 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (5-fluoro-3,6-dihydro-2H-pyridin-1-yl)-(5-hydroxy-6-iodo-3-pyridinyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-fluoro-3,6-dihydro-2H-pyridin-1-yl)-(5-hydroxy-6-iodo-3-pyridinyl)methanone?
The IUPAC name of (5-fluoro-3,6-dihydro-2H-pyridin-1-yl)-(5-hydroxy-6-iodo-3-pyridinyl)methanone (CID 127266155) is (5-fluoro-3,6-dihydro-2H-pyridin-1-yl)-(5-hydroxy-6-iodo-3-pyridinyl)methanone.
What is the SMILES notation for (5-fluoro-3,6-dihydro-2H-pyridin-1-yl)-(5-hydroxy-6-iodo-3-pyridinyl)methanone?
The canonical SMILES for (5-fluoro-3,6-dihydro-2H-pyridin-1-yl)-(5-hydroxy-6-iodo-3-pyridinyl)methanone is O=C(c1cnc(I)c(O)c1)N1CCC=C(F)C1.
What is the InChIKey of (5-fluoro-3,6-dihydro-2H-pyridin-1-yl)-(5-hydroxy-6-iodo-3-pyridinyl)methanone?
The InChIKey is GIVUQAXASVAYIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10FIN2O2/c12-8-2-1-3-15(6-8)11(17)7-4-9(16)10(13)14-5-7/h2,4-5,16H,1,3,6H2.
What are the key properties of (5-fluoro-3,6-dihydro-2H-pyridin-1-yl)-(5-hydroxy-6-iodo-3-pyridinyl)methanone?
(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)-(5-hydroxy-6-iodo-3-pyridinyl)methanone has a molecular weight of 348.12 g/mol, XLogP of 2.09, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5-fluoro-3,6-dihydro-2H-pyridin-1-yl)-(5-hydroxy-6-iodo-3-pyridinyl)methanone is sourced from PubChem (CID 127266155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).