About ethyl 1-[2-[(7-chloropyrido[2,3-d]pyrimidin-4-yl)amino]ethyl]imidazole-4-carboxylate
ethyl 1-[2-[(7-chloropyrido[2,3-d]pyrimidin-4-yl)amino]ethyl]imidazole-4-carboxylate (PubChem CID 127266751) has the molecular formula C15H15ClN6O2
and a molecular weight of 346.78 g/mol. Its IUPAC name is ethyl 1-[2-[(7-chloropyrido[2,3-d]pyrimidin-4-yl)amino]ethyl]imidazole-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-[2-[(7-chloropyrido[2,3-d]pyrimidin-4-yl)amino]ethyl]imidazole-4-carboxylate |
| PubChem CID | 127266751 |
| Molecular Formula | C15H15ClN6O2 |
| Molecular Weight | 346.78 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | ethyl 1-[2-[(7-chloropyrido[2,3-d]pyrimidin-4-yl)amino]ethyl]imidazole-4-carboxylate |
| SMILES | CCOC(=O)c1cn(CCNc2ncnc3nc(Cl)ccc23)cn1 |
| InChI | InChI=1S/C15H15ClN6O2/c1-2-24-15(23)11-7-22(9-20-11)6-5-17-13-10-3-4-12(16)21-14(10)19-8-18-13/h3-4,7-9H,2,5-6H2,1H3,(H,17,18,19,21) |
| InChIKey | ANHZVLDQGTVIBR-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.78 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze ethyl 1-[2-[(7-chloropyrido[2,3-d]pyrimidin-4-yl)amino]ethyl]imidazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-[2-[(7-chloropyrido[2,3-d]pyrimidin-4-yl)amino]ethyl]imidazole-4-carboxylate?
The IUPAC name of ethyl 1-[2-[(7-chloropyrido[2,3-d]pyrimidin-4-yl)amino]ethyl]imidazole-4-carboxylate (CID 127266751) is ethyl 1-[2-[(7-chloropyrido[2,3-d]pyrimidin-4-yl)amino]ethyl]imidazole-4-carboxylate.
What is the SMILES notation for ethyl 1-[2-[(7-chloropyrido[2,3-d]pyrimidin-4-yl)amino]ethyl]imidazole-4-carboxylate?
The canonical SMILES for ethyl 1-[2-[(7-chloropyrido[2,3-d]pyrimidin-4-yl)amino]ethyl]imidazole-4-carboxylate is CCOC(=O)c1cn(CCNc2ncnc3nc(Cl)ccc23)cn1.
What is the InChIKey of ethyl 1-[2-[(7-chloropyrido[2,3-d]pyrimidin-4-yl)amino]ethyl]imidazole-4-carboxylate?
The InChIKey is ANHZVLDQGTVIBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15ClN6O2/c1-2-24-15(23)11-7-22(9-20-11)6-5-17-13-10-3-4-12(16)21-14(10)19-8-18-13/h3-4,7-9H,2,5-6H2,1H3,(H,17,18,19,21).
What are the key properties of ethyl 1-[2-[(7-chloropyrido[2,3-d]pyrimidin-4-yl)amino]ethyl]imidazole-4-carboxylate?
ethyl 1-[2-[(7-chloropyrido[2,3-d]pyrimidin-4-yl)amino]ethyl]imidazole-4-carboxylate has a molecular weight of 346.78 g/mol, XLogP of 2.16, 6 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-[2-[(7-chloropyrido[2,3-d]pyrimidin-4-yl)amino]ethyl]imidazole-4-carboxylate is sourced from PubChem (CID 127266751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).