C19H21N3O3 — CID 127267207
1-(4-hydroxy-1-phenylbutyl)-3-(3-methyl-1,2-benzoxazol-6-yl)urea (PubChem CID 127267207) has the molecular formula C19H21N3O3 and a molecular weight of 339.40 g/mol. Its IUPAC name is 1-(4-hydroxy-1-phenylbutyl)-3-(3-methyl-1,2-benzoxazol-6-yl)urea.
| Compound Name | 1-(4-hydroxy-1-phenylbutyl)-3-(3-methyl-1,2-benzoxazol-6-yl)urea |
|---|---|
| PubChem CID | 127267207 |
| Molecular Formula | C19H21N3O3 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | 1-(4-hydroxy-1-phenylbutyl)-3-(3-methyl-1,2-benzoxazol-6-yl)urea |
| SMILES | Cc1noc2cc(NC(=O)NC(CCCO)c3ccccc3)ccc12 |
| InChI | InChI=1S/C19H21N3O3/c1-13-16-10-9-15(12-18(16)25-22-13)20-19(24)21-17(8-5-11-23)14-6-3-2-4-7-14/h2-4,6-7,9-10,12,17,23H,5,8,11H2,1H3,(H2,20,21,24) |
| InChIKey | UYHZYBCWFPLTOV-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 87.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |