C12H14OS2 — CID 12726730
2-(1,3-dithiolan-2-yl)-1-phenylpropan-1-one (PubChem CID 12726730) has the molecular formula C12H14OS2 and a molecular weight of 238.38 g/mol. Its IUPAC name is 2-(1,3-dithiolan-2-yl)-1-phenylpropan-1-one.
| Compound Name | 2-(1,3-dithiolan-2-yl)-1-phenylpropan-1-one |
|---|---|
| PubChem CID | 12726730 |
| Molecular Formula | C12H14OS2 |
| Molecular Weight | 238.38 g/mol |
| Exact Mass | 238.05 |
| IUPAC Name | 2-(1,3-dithiolan-2-yl)-1-phenylpropan-1-one |
| SMILES | CC(C(=O)c1ccccc1)C1SCCS1 |
| InChI | InChI=1S/C12H14OS2/c1-9(12-14-7-8-15-12)11(13)10-5-3-2-4-6-10/h2-6,9,12H,7-8H2,1H3 |
| InChIKey | CUWRVSZDBJBRCU-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.38 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |