About ethyl 2-(1,3-dithiolan-2-yl)butanoate
ethyl 2-(1,3-dithiolan-2-yl)butanoate (PubChem CID 12726731) has the molecular formula C9H16O2S2
and a molecular weight of 220.36 g/mol. Its IUPAC name is ethyl 2-(1,3-dithiolan-2-yl)butanoate.
Molecular Properties
| Compound Name | ethyl 2-(1,3-dithiolan-2-yl)butanoate |
| PubChem CID | 12726731 |
| Molecular Formula | C9H16O2S2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.06 |
| IUPAC Name | ethyl 2-(1,3-dithiolan-2-yl)butanoate |
| SMILES | CCOC(=O)C(CC)C1SCCS1 |
| InChI | InChI=1S/C9H16O2S2/c1-3-7(8(10)11-4-2)9-12-5-6-13-9/h7,9H,3-6H2,1-2H3 |
| InChIKey | RTESQWJJDVFASN-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 2-(1,3-dithiolan-2-yl)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(1,3-dithiolan-2-yl)butanoate?
The IUPAC name of ethyl 2-(1,3-dithiolan-2-yl)butanoate (CID 12726731) is ethyl 2-(1,3-dithiolan-2-yl)butanoate.
What is the SMILES notation for ethyl 2-(1,3-dithiolan-2-yl)butanoate?
The canonical SMILES for ethyl 2-(1,3-dithiolan-2-yl)butanoate is CCOC(=O)C(CC)C1SCCS1.
What is the InChIKey of ethyl 2-(1,3-dithiolan-2-yl)butanoate?
The InChIKey is RTESQWJJDVFASN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O2S2/c1-3-7(8(10)11-4-2)9-12-5-6-13-9/h7,9H,3-6H2,1-2H3.
What are the key properties of ethyl 2-(1,3-dithiolan-2-yl)butanoate?
ethyl 2-(1,3-dithiolan-2-yl)butanoate has a molecular weight of 220.36 g/mol, XLogP of 2.38, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(1,3-dithiolan-2-yl)butanoate is sourced from PubChem (CID 12726731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).