About 3-cyclohexyl-N-[3-(3,5-dimethylpyrazol-1-yl)phenyl]-1-methylpyrazole-4-carboxamide
3-cyclohexyl-N-[3-(3,5-dimethylpyrazol-1-yl)phenyl]-1-methylpyrazole-4-carboxamide (PubChem CID 127271659) has the molecular formula C22H27N5O
and a molecular weight of 377.49 g/mol. Its IUPAC name is 3-cyclohexyl-N-[3-(3,5-dimethylpyrazol-1-yl)phenyl]-1-methylpyrazole-4-carboxamide.
Molecular Properties
| Compound Name | 3-cyclohexyl-N-[3-(3,5-dimethylpyrazol-1-yl)phenyl]-1-methylpyrazole-4-carboxamide |
| PubChem CID | 127271659 |
| Molecular Formula | C22H27N5O |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.22 |
| IUPAC Name | 3-cyclohexyl-N-[3-(3,5-dimethylpyrazol-1-yl)phenyl]-1-methylpyrazole-4-carboxamide |
| SMILES | Cc1cc(C)n(-c2cccc(NC(=O)c3cn(C)nc3C3CCCCC3)c2)n1 |
| InChI | InChI=1S/C22H27N5O/c1-15-12-16(2)27(24-15)19-11-7-10-18(13-19)23-22(28)20-14-26(3)25-21(20)17-8-5-4-6-9-17/h7,10-14,17H,4-6,8-9H2,1-3H3,(H,23,28) |
| InChIKey | ITUBHIHWBIYWNH-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-cyclohexyl-N-[3-(3,5-dimethylpyrazol-1-yl)phenyl]-1-methylpyrazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclohexyl-N-[3-(3,5-dimethylpyrazol-1-yl)phenyl]-1-methylpyrazole-4-carboxamide?
The IUPAC name of 3-cyclohexyl-N-[3-(3,5-dimethylpyrazol-1-yl)phenyl]-1-methylpyrazole-4-carboxamide (CID 127271659) is 3-cyclohexyl-N-[3-(3,5-dimethylpyrazol-1-yl)phenyl]-1-methylpyrazole-4-carboxamide.
What is the SMILES notation for 3-cyclohexyl-N-[3-(3,5-dimethylpyrazol-1-yl)phenyl]-1-methylpyrazole-4-carboxamide?
The canonical SMILES for 3-cyclohexyl-N-[3-(3,5-dimethylpyrazol-1-yl)phenyl]-1-methylpyrazole-4-carboxamide is Cc1cc(C)n(-c2cccc(NC(=O)c3cn(C)nc3C3CCCCC3)c2)n1.
What is the InChIKey of 3-cyclohexyl-N-[3-(3,5-dimethylpyrazol-1-yl)phenyl]-1-methylpyrazole-4-carboxamide?
The InChIKey is ITUBHIHWBIYWNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H27N5O/c1-15-12-16(2)27(24-15)19-11-7-10-18(13-19)23-22(28)20-14-26(3)25-21(20)17-8-5-4-6-9-17/h7,10-14,17H,4-6,8-9H2,1-3H3,(H,23,28).
What are the key properties of 3-cyclohexyl-N-[3-(3,5-dimethylpyrazol-1-yl)phenyl]-1-methylpyrazole-4-carboxamide?
3-cyclohexyl-N-[3-(3,5-dimethylpyrazol-1-yl)phenyl]-1-methylpyrazole-4-carboxamide has a molecular weight of 377.49 g/mol, XLogP of 4.52, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclohexyl-N-[3-(3,5-dimethylpyrazol-1-yl)phenyl]-1-methylpyrazole-4-carboxamide is sourced from PubChem (CID 127271659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).