C11H8Cl2O2 — CID 12727187
(1S,2R,5S,6R,7R,9S)-8,8-dichlorotetracyclo[4.3.1.12,5.07,9]undec-3-ene-10,11-dione (PubChem CID 12727187) has the molecular formula C11H8Cl2O2 and a molecular weight of 243.09 g/mol. Its IUPAC name is (1S,2R,5S,6R,7R,9S)-8,8-dichlorotetracyclo[4.3.1.12,5.07,9]undec-3-ene-10,11-dione.
| Compound Name | (1S,2R,5S,6R,7R,9S)-8,8-dichlorotetracyclo[4.3.1.12,5.07,9]undec-3-ene-10,11-dione |
|---|---|
| PubChem CID | 12727187 |
| Molecular Formula | C11H8Cl2O2 |
| Molecular Weight | 243.09 g/mol |
| Exact Mass | 241.99 |
| IUPAC Name | (1S,2R,5S,6R,7R,9S)-8,8-dichlorotetracyclo[4.3.1.12,5.07,9]undec-3-ene-10,11-dione |
| SMILES | O=C1[C@@H]2[C@H]3[C@@H]([C@H]1[C@@H]1C=C[C@H]2C1=O)C3(Cl)Cl |
| InChI | InChI=1S/C11H8Cl2O2/c12-11(13)7-5-3-1-2-4(9(3)14)6(8(7)11)10(5)15/h1-8H/t3-,4+,5+,6-,7+,8- |
| InChIKey | AMVQHAUJHZWDBD-COPVUAKWSA-N |
| XLogP | 1.61 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.09 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cycloheptane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|