About (3-oxo-7-oxatetracyclo[6.4.0.02,6.04,9]dodecan-10-yl) 4-methylbenzenesulfonate
(3-oxo-7-oxatetracyclo[6.4.0.02,6.04,9]dodecan-10-yl) 4-methylbenzenesulfonate (PubChem CID 12727237) has the molecular formula C18H20O5S
and a molecular weight of 348.42 g/mol. Its IUPAC name is (3-oxo-7-oxatetracyclo[6.4.0.02,6.04,9]dodecan-10-yl) 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | (3-oxo-7-oxatetracyclo[6.4.0.02,6.04,9]dodecan-10-yl) 4-methylbenzenesulfonate |
| PubChem CID | 12727237 |
| Molecular Formula | C18H20O5S |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | (3-oxo-7-oxatetracyclo[6.4.0.02,6.04,9]dodecan-10-yl) 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC2CCC3C4OC5CC(C(=O)C53)C24)cc1 |
| InChI | InChI=1S/C18H20O5S/c1-9-2-4-10(5-3-9)24(20,21)23-13-7-6-11-15-14-8-12(17(15)19)16(13)18(11)22-14/h2-5,11-16,18H,6-8H2,1H3 |
| InChIKey | PAKDDIPHXSSKPW-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (3-oxo-7-oxatetracyclo[6.4.0.02,6.04,9]dodecan-10-yl) 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-oxo-7-oxatetracyclo[6.4.0.02,6.04,9]dodecan-10-yl) 4-methylbenzenesulfonate?
The IUPAC name of (3-oxo-7-oxatetracyclo[6.4.0.02,6.04,9]dodecan-10-yl) 4-methylbenzenesulfonate (CID 12727237) is (3-oxo-7-oxatetracyclo[6.4.0.02,6.04,9]dodecan-10-yl) 4-methylbenzenesulfonate.
What is the SMILES notation for (3-oxo-7-oxatetracyclo[6.4.0.02,6.04,9]dodecan-10-yl) 4-methylbenzenesulfonate?
The canonical SMILES for (3-oxo-7-oxatetracyclo[6.4.0.02,6.04,9]dodecan-10-yl) 4-methylbenzenesulfonate is Cc1ccc(S(=O)(=O)OC2CCC3C4OC5CC(C(=O)C53)C24)cc1.
What is the InChIKey of (3-oxo-7-oxatetracyclo[6.4.0.02,6.04,9]dodecan-10-yl) 4-methylbenzenesulfonate?
The InChIKey is PAKDDIPHXSSKPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20O5S/c1-9-2-4-10(5-3-9)24(20,21)23-13-7-6-11-15-14-8-12(17(15)19)16(13)18(11)22-14/h2-5,11-16,18H,6-8H2,1H3.
What are the key properties of (3-oxo-7-oxatetracyclo[6.4.0.02,6.04,9]dodecan-10-yl) 4-methylbenzenesulfonate?
(3-oxo-7-oxatetracyclo[6.4.0.02,6.04,9]dodecan-10-yl) 4-methylbenzenesulfonate has a molecular weight of 348.42 g/mol, XLogP of 2.08, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-oxo-7-oxatetracyclo[6.4.0.02,6.04,9]dodecan-10-yl) 4-methylbenzenesulfonate is sourced from PubChem (CID 12727237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).