About methyl 3a,4-dihydro-3H-pyrazolo[1,5-a]indole-2-carboxylate
methyl 3a,4-dihydro-3H-pyrazolo[1,5-a]indole-2-carboxylate (PubChem CID 12727543) has the molecular formula C12H12N2O2
and a molecular weight of 216.24 g/mol. Its IUPAC name is methyl 3a,4-dihydro-3H-pyrazolo[1,5-a]indole-2-carboxylate.
Molecular Properties
| Compound Name | methyl 3a,4-dihydro-3H-pyrazolo[1,5-a]indole-2-carboxylate |
| PubChem CID | 12727543 |
| Molecular Formula | C12H12N2O2 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | methyl 3a,4-dihydro-3H-pyrazolo[1,5-a]indole-2-carboxylate |
| SMILES | COC(=O)C1=NN2c3ccccc3CC2C1 |
| InChI | InChI=1S/C12H12N2O2/c1-16-12(15)10-7-9-6-8-4-2-3-5-11(8)14(9)13-10/h2-5,9H,6-7H2,1H3 |
| InChIKey | WPLRNUIGENZBHI-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 3a,4-dihydro-3H-pyrazolo[1,5-a]indole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3a,4-dihydro-3H-pyrazolo[1,5-a]indole-2-carboxylate?
The IUPAC name of methyl 3a,4-dihydro-3H-pyrazolo[1,5-a]indole-2-carboxylate (CID 12727543) is methyl 3a,4-dihydro-3H-pyrazolo[1,5-a]indole-2-carboxylate.
What is the SMILES notation for methyl 3a,4-dihydro-3H-pyrazolo[1,5-a]indole-2-carboxylate?
The canonical SMILES for methyl 3a,4-dihydro-3H-pyrazolo[1,5-a]indole-2-carboxylate is COC(=O)C1=NN2c3ccccc3CC2C1.
What is the InChIKey of methyl 3a,4-dihydro-3H-pyrazolo[1,5-a]indole-2-carboxylate?
The InChIKey is WPLRNUIGENZBHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O2/c1-16-12(15)10-7-9-6-8-4-2-3-5-11(8)14(9)13-10/h2-5,9H,6-7H2,1H3.
What are the key properties of methyl 3a,4-dihydro-3H-pyrazolo[1,5-a]indole-2-carboxylate?
methyl 3a,4-dihydro-3H-pyrazolo[1,5-a]indole-2-carboxylate has a molecular weight of 216.24 g/mol, XLogP of 1.35, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3a,4-dihydro-3H-pyrazolo[1,5-a]indole-2-carboxylate is sourced from PubChem (CID 12727543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).