C12H26BNO3 — CID 12727580
N,N-diethyl-2-[(4,4,6-trimethyl-1,3,2-dioxaborinan-2-yl)oxy]ethanamine (PubChem CID 12727580) has the molecular formula C12H26BNO3 and a molecular weight of 243.16 g/mol. Its IUPAC name is N,N-diethyl-2-[(4,4,6-trimethyl-1,3,2-dioxaborinan-2-yl)oxy]ethanamine.
| Compound Name | N,N-diethyl-2-[(4,4,6-trimethyl-1,3,2-dioxaborinan-2-yl)oxy]ethanamine |
|---|---|
| PubChem CID | 12727580 |
| Molecular Formula | C12H26BNO3 |
| Molecular Weight | 243.16 g/mol |
| Exact Mass | 243.20 |
| IUPAC Name | N,N-diethyl-2-[(4,4,6-trimethyl-1,3,2-dioxaborinan-2-yl)oxy]ethanamine |
| SMILES | CCN(CC)CCOB1OC(C)CC(C)(C)O1 |
| InChI | InChI=1S/C12H26BNO3/c1-6-14(7-2)8-9-15-13-16-11(3)10-12(4,5)17-13/h11H,6-10H2,1-5H3 |
| InChIKey | QZHIQVANQYEWDA-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.16 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|