About 2-(dipropylamino)-2,3-dihydro-1H-inden-5-ol
2-(dipropylamino)-2,3-dihydro-1H-inden-5-ol (PubChem CID 12728243) has the molecular formula C15H23NO
and a molecular weight of 233.35 g/mol. Its IUPAC name is 2-(dipropylamino)-2,3-dihydro-1H-inden-5-ol.
Molecular Properties
| Compound Name | 2-(dipropylamino)-2,3-dihydro-1H-inden-5-ol |
| PubChem CID | 12728243 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.35 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | 2-(dipropylamino)-2,3-dihydro-1H-inden-5-ol |
| SMILES | CCCN(CCC)C1Cc2ccc(O)cc2C1 |
| InChI | InChI=1S/C15H23NO/c1-3-7-16(8-4-2)14-9-12-5-6-15(17)11-13(12)10-14/h5-6,11,14,17H,3-4,7-10H2,1-2H3 |
| InChIKey | CGVTXQCPDIZHAI-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.35 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(dipropylamino)-2,3-dihydro-1H-inden-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dipropylamino)-2,3-dihydro-1H-inden-5-ol?
The IUPAC name of 2-(dipropylamino)-2,3-dihydro-1H-inden-5-ol (CID 12728243) is 2-(dipropylamino)-2,3-dihydro-1H-inden-5-ol.
What is the SMILES notation for 2-(dipropylamino)-2,3-dihydro-1H-inden-5-ol?
The canonical SMILES for 2-(dipropylamino)-2,3-dihydro-1H-inden-5-ol is CCCN(CCC)C1Cc2ccc(O)cc2C1.
What is the InChIKey of 2-(dipropylamino)-2,3-dihydro-1H-inden-5-ol?
The InChIKey is CGVTXQCPDIZHAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23NO/c1-3-7-16(8-4-2)14-9-12-5-6-15(17)11-13(12)10-14/h5-6,11,14,17H,3-4,7-10H2,1-2H3.
What are the key properties of 2-(dipropylamino)-2,3-dihydro-1H-inden-5-ol?
2-(dipropylamino)-2,3-dihydro-1H-inden-5-ol has a molecular weight of 233.35 g/mol, XLogP of 2.98, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dipropylamino)-2,3-dihydro-1H-inden-5-ol is sourced from PubChem (CID 12728243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).