About 7-benzyl-1-oxa-7,10-diazaspiro[4.5]decane-6,9-dione
7-benzyl-1-oxa-7,10-diazaspiro[4.5]decane-6,9-dione (PubChem CID 12728438) has the molecular formula C14H16N2O3
and a molecular weight of 260.29 g/mol. Its IUPAC name is 7-benzyl-1-oxa-7,10-diazaspiro[4.5]decane-6,9-dione.
Molecular Properties
| Compound Name | 7-benzyl-1-oxa-7,10-diazaspiro[4.5]decane-6,9-dione |
| PubChem CID | 12728438 |
| Molecular Formula | C14H16N2O3 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | 7-benzyl-1-oxa-7,10-diazaspiro[4.5]decane-6,9-dione |
| SMILES | O=C1CN(Cc2ccccc2)C(=O)C2(CCCO2)N1 |
| InChI | InChI=1S/C14H16N2O3/c17-12-10-16(9-11-5-2-1-3-6-11)13(18)14(15-12)7-4-8-19-14/h1-3,5-6H,4,7-10H2,(H,15,17) |
| InChIKey | DJSMFPOOTHEQMK-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-benzyl-1-oxa-7,10-diazaspiro[4.5]decane-6,9-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-benzyl-1-oxa-7,10-diazaspiro[4.5]decane-6,9-dione?
The IUPAC name of 7-benzyl-1-oxa-7,10-diazaspiro[4.5]decane-6,9-dione (CID 12728438) is 7-benzyl-1-oxa-7,10-diazaspiro[4.5]decane-6,9-dione.
What is the SMILES notation for 7-benzyl-1-oxa-7,10-diazaspiro[4.5]decane-6,9-dione?
The canonical SMILES for 7-benzyl-1-oxa-7,10-diazaspiro[4.5]decane-6,9-dione is O=C1CN(Cc2ccccc2)C(=O)C2(CCCO2)N1.
What is the InChIKey of 7-benzyl-1-oxa-7,10-diazaspiro[4.5]decane-6,9-dione?
The InChIKey is DJSMFPOOTHEQMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2O3/c17-12-10-16(9-11-5-2-1-3-6-11)13(18)14(15-12)7-4-8-19-14/h1-3,5-6H,4,7-10H2,(H,15,17).
What are the key properties of 7-benzyl-1-oxa-7,10-diazaspiro[4.5]decane-6,9-dione?
7-benzyl-1-oxa-7,10-diazaspiro[4.5]decane-6,9-dione has a molecular weight of 260.29 g/mol, XLogP of 0.65, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-benzyl-1-oxa-7,10-diazaspiro[4.5]decane-6,9-dione is sourced from PubChem (CID 12728438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).