About N-methyl-3-phenyl-1,2,4-oxadiazol-5-amine
N-methyl-3-phenyl-1,2,4-oxadiazol-5-amine (PubChem CID 12728457) has the molecular formula C9H9N3O
and a molecular weight of 175.19 g/mol. Its IUPAC name is N-methyl-3-phenyl-1,2,4-oxadiazol-5-amine.
Molecular Properties
| Compound Name | N-methyl-3-phenyl-1,2,4-oxadiazol-5-amine |
| PubChem CID | 12728457 |
| Molecular Formula | C9H9N3O |
| Molecular Weight | 175.19 g/mol |
| Exact Mass | 175.07 |
| IUPAC Name | N-methyl-3-phenyl-1,2,4-oxadiazol-5-amine |
| SMILES | CNc1nc(-c2ccccc2)no1 |
| InChI | InChI=1S/C9H9N3O/c1-10-9-11-8(12-13-9)7-5-3-2-4-6-7/h2-6H,1H3,(H,10,11,12) |
| InChIKey | ASCRDDKMHIKBII-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.19 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-methyl-3-phenyl-1,2,4-oxadiazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-3-phenyl-1,2,4-oxadiazol-5-amine?
The IUPAC name of N-methyl-3-phenyl-1,2,4-oxadiazol-5-amine (CID 12728457) is N-methyl-3-phenyl-1,2,4-oxadiazol-5-amine.
What is the SMILES notation for N-methyl-3-phenyl-1,2,4-oxadiazol-5-amine?
The canonical SMILES for N-methyl-3-phenyl-1,2,4-oxadiazol-5-amine is CNc1nc(-c2ccccc2)no1.
What is the InChIKey of N-methyl-3-phenyl-1,2,4-oxadiazol-5-amine?
The InChIKey is ASCRDDKMHIKBII-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3O/c1-10-9-11-8(12-13-9)7-5-3-2-4-6-7/h2-6H,1H3,(H,10,11,12).
What are the key properties of N-methyl-3-phenyl-1,2,4-oxadiazol-5-amine?
N-methyl-3-phenyl-1,2,4-oxadiazol-5-amine has a molecular weight of 175.19 g/mol, XLogP of 1.78, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-3-phenyl-1,2,4-oxadiazol-5-amine is sourced from PubChem (CID 12728457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).