C9H19NO — CID 12728907
2,3,4,5,6-pentamethylmorpholine (PubChem CID 12728907) has the molecular formula C9H19NO and a molecular weight of 157.26 g/mol. Its IUPAC name is 2,3,4,5,6-pentamethylmorpholine.
| Compound Name | 2,3,4,5,6-pentamethylmorpholine |
|---|---|
| PubChem CID | 12728907 |
| Molecular Formula | C9H19NO |
| Molecular Weight | 157.26 g/mol |
| Exact Mass | 157.15 |
| IUPAC Name | 2,3,4,5,6-pentamethylmorpholine |
| SMILES | CC1OC(C)C(C)N(C)C1C |
| InChI | InChI=1S/C9H19NO/c1-6-8(3)11-9(4)7(2)10(6)5/h6-9H,1-5H3 |
| InChIKey | WRFGMXWDQDQRKO-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.26 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |