About 4-ethyl-2,3,5,6-tetramethylmorpholine
4-ethyl-2,3,5,6-tetramethylmorpholine (PubChem CID 12728922) has the molecular formula C10H21NO
and a molecular weight of 171.28 g/mol. Its IUPAC name is 4-ethyl-2,3,5,6-tetramethylmorpholine.
Molecular Properties
| Compound Name | 4-ethyl-2,3,5,6-tetramethylmorpholine |
| PubChem CID | 12728922 |
| Molecular Formula | C10H21NO |
| Molecular Weight | 171.28 g/mol |
| Exact Mass | 171.16 |
| IUPAC Name | 4-ethyl-2,3,5,6-tetramethylmorpholine |
| SMILES | CCN1C(C)C(C)OC(C)C1C |
| InChI | InChI=1S/C10H21NO/c1-6-11-7(2)9(4)12-10(5)8(11)3/h7-10H,6H2,1-5H3 |
| InChIKey | GMMKZPXBLTYEIV-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.28 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-ethyl-2,3,5,6-tetramethylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-2,3,5,6-tetramethylmorpholine?
The IUPAC name of 4-ethyl-2,3,5,6-tetramethylmorpholine (CID 12728922) is 4-ethyl-2,3,5,6-tetramethylmorpholine.
What is the SMILES notation for 4-ethyl-2,3,5,6-tetramethylmorpholine?
The canonical SMILES for 4-ethyl-2,3,5,6-tetramethylmorpholine is CCN1C(C)C(C)OC(C)C1C.
What is the InChIKey of 4-ethyl-2,3,5,6-tetramethylmorpholine?
The InChIKey is GMMKZPXBLTYEIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21NO/c1-6-11-7(2)9(4)12-10(5)8(11)3/h7-10H,6H2,1-5H3.
What are the key properties of 4-ethyl-2,3,5,6-tetramethylmorpholine?
4-ethyl-2,3,5,6-tetramethylmorpholine has a molecular weight of 171.28 g/mol, XLogP of 1.89, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-2,3,5,6-tetramethylmorpholine is sourced from PubChem (CID 12728922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).