C11H18 — CID 12729281
1a,2,3,3a,4,5,6,7,7a,7b-decahydro-1H-cyclopropa[a]naphthalene (PubChem CID 12729281) has the molecular formula C11H18 and a molecular weight of 150.26 g/mol. Its IUPAC name is 1a,2,3,3a,4,5,6,7,7a,7b-decahydro-1H-cyclopropa[a]naphthalene.
| Compound Name | 1a,2,3,3a,4,5,6,7,7a,7b-decahydro-1H-cyclopropa[a]naphthalene |
|---|---|
| PubChem CID | 12729281 |
| Molecular Formula | C11H18 |
| Molecular Weight | 150.26 g/mol |
| Exact Mass | 150.14 |
| IUPAC Name | 1a,2,3,3a,4,5,6,7,7a,7b-decahydro-1H-cyclopropa[a]naphthalene |
| SMILES | C1CCC2C(C1)CCC1CC12 |
| InChI | InChI=1S/C11H18/c1-2-4-10-8(3-1)5-6-9-7-11(9)10/h8-11H,1-7H2 |
| InChIKey | ZAUJDUNVDTUNDD-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.26 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |