About 2-(butoxymethyl)buta-2,3-dienyl-trimethylsilane
2-(butoxymethyl)buta-2,3-dienyl-trimethylsilane (PubChem CID 12729466) has the molecular formula C12H24OSi
and a molecular weight of 212.41 g/mol. Its IUPAC name is 2-(butoxymethyl)buta-2,3-dienyl-trimethylsilane.
Molecular Properties
| Compound Name | 2-(butoxymethyl)buta-2,3-dienyl-trimethylsilane |
| PubChem CID | 12729466 |
| Molecular Formula | C12H24OSi |
| Molecular Weight | 212.41 g/mol |
| Exact Mass | 212.16 |
| IUPAC Name | 2-(butoxymethyl)buta-2,3-dienyl-trimethylsilane |
| SMILES | C=C=C(COCCCC)C[Si](C)(C)C |
| InChI | InChI=1S/C12H24OSi/c1-6-8-9-13-10-12(7-2)11-14(3,4)5/h2,6,8-11H2,1,3-5H3 |
| InChIKey | AABZSKJMFMKFHD-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.41 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-(butoxymethyl)buta-2,3-dienyl-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(butoxymethyl)buta-2,3-dienyl-trimethylsilane?
The IUPAC name of 2-(butoxymethyl)buta-2,3-dienyl-trimethylsilane (CID 12729466) is 2-(butoxymethyl)buta-2,3-dienyl-trimethylsilane.
What is the SMILES notation for 2-(butoxymethyl)buta-2,3-dienyl-trimethylsilane?
The canonical SMILES for 2-(butoxymethyl)buta-2,3-dienyl-trimethylsilane is C=C=C(COCCCC)C[Si](C)(C)C.
What is the InChIKey of 2-(butoxymethyl)buta-2,3-dienyl-trimethylsilane?
The InChIKey is AABZSKJMFMKFHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24OSi/c1-6-8-9-13-10-12(7-2)11-14(3,4)5/h2,6,8-11H2,1,3-5H3.
What are the key properties of 2-(butoxymethyl)buta-2,3-dienyl-trimethylsilane?
2-(butoxymethyl)buta-2,3-dienyl-trimethylsilane has a molecular weight of 212.41 g/mol, XLogP of 3.85, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(butoxymethyl)buta-2,3-dienyl-trimethylsilane is sourced from PubChem (CID 12729466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).