C33H27NO — CID 12729559
3a-methyl-2-(4-methylphenyl)-4,6,7a-triphenyl-1,3-benzoxazole (PubChem CID 12729559) has the molecular formula C33H27NO and a molecular weight of 453.59 g/mol. Its IUPAC name is 3a-methyl-2-(4-methylphenyl)-4,6,7a-triphenyl-1,3-benzoxazole.
| Compound Name | 3a-methyl-2-(4-methylphenyl)-4,6,7a-triphenyl-1,3-benzoxazole |
|---|---|
| PubChem CID | 12729559 |
| Molecular Formula | C33H27NO |
| Molecular Weight | 453.59 g/mol |
| Exact Mass | 453.21 |
| IUPAC Name | 3a-methyl-2-(4-methylphenyl)-4,6,7a-triphenyl-1,3-benzoxazole |
| SMILES | Cc1ccc(C2=NC3(C)C(c4ccccc4)=CC(c4ccccc4)=CC3(c3ccccc3)O2)cc1 |
| InChI | InChI=1S/C33H27NO/c1-24-18-20-27(21-19-24)31-34-32(2)30(26-14-8-4-9-15-26)22-28(25-12-6-3-7-13-25)23-33(32,35-31)29-16-10-5-11-17-29/h3-23H,1-2H3 |
| InChIKey | MDYNYTIGGNVZCC-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.59 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |