C13H20O — CID 12729630
(1R,4R,9R)-10,10-dimethyltricyclo[7.1.1.02,7]undec-2(7)-en-4-ol (PubChem CID 12729630) has the molecular formula C13H20O and a molecular weight of 192.30 g/mol. Its IUPAC name is (1R,4R,9R)-10,10-dimethyltricyclo[7.1.1.02,7]undec-2(7)-en-4-ol.
| Compound Name | (1R,4R,9R)-10,10-dimethyltricyclo[7.1.1.02,7]undec-2(7)-en-4-ol |
|---|---|
| PubChem CID | 12729630 |
| Molecular Formula | C13H20O |
| Molecular Weight | 192.30 g/mol |
| Exact Mass | 192.15 |
| IUPAC Name | (1R,4R,9R)-10,10-dimethyltricyclo[7.1.1.02,7]undec-2(7)-en-4-ol |
| SMILES | CC1(C)[C@H]2CC3=C(C[C@H](O)CC3)[C@@H]1C2 |
| InChI | InChI=1S/C13H20O/c1-13(2)9-5-8-3-4-10(14)7-11(8)12(13)6-9/h9-10,12,14H,3-7H2,1-2H3/t9-,10+,12-/m0/s1 |
| InChIKey | NCCAWLQFTLGMPU-UMNHJUIQSA-N |
| XLogP | 2.89 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.30 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|