C27H27N3O3S — CID 1272985
2-[3-(4-ethoxyphenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(2-ethyl-6-methylphenyl)acetamide (PubChem CID 1272985) has the molecular formula C27H27N3O3S and a molecular weight of 473.60 g/mol. Its IUPAC name is 2-[3-(4-ethoxyphenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(2-ethyl-6-methylphenyl)acetamide.
| Compound Name | 2-[3-(4-ethoxyphenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(2-ethyl-6-methylphenyl)acetamide |
|---|---|
| PubChem CID | 1272985 |
| Molecular Formula | C27H27N3O3S |
| Molecular Weight | 473.60 g/mol |
| Exact Mass | 473.18 |
| IUPAC Name | 2-[3-(4-ethoxyphenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(2-ethyl-6-methylphenyl)acetamide |
| SMILES | CCOc1ccc(-n2c(SCC(=O)Nc3c(C)cccc3CC)nc3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C27H27N3O3S/c1-4-19-10-8-9-18(3)25(19)29-24(31)17-34-27-28-23-12-7-6-11-22(23)26(32)30(27)20-13-15-21(16-14-20)33-5-2/h6-16H,4-5,17H2,1-3H3,(H,29,31) |
| InChIKey | AYIMQZNAIAXCQP-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.60 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |