C12H22N2O5S — CID 127300025
N-(1-morpholin-4-yl-1-oxopropan-2-yl)-1-(oxolan-3-yl)methanesulfonamide (PubChem CID 127300025) has the molecular formula C12H22N2O5S and a molecular weight of 306.38 g/mol. Its IUPAC name is N-(1-morpholin-4-yl-1-oxopropan-2-yl)-1-(oxolan-3-yl)methanesulfonamide.
| Compound Name | N-(1-morpholin-4-yl-1-oxopropan-2-yl)-1-(oxolan-3-yl)methanesulfonamide |
|---|---|
| PubChem CID | 127300025 |
| Molecular Formula | C12H22N2O5S |
| Molecular Weight | 306.38 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | N-(1-morpholin-4-yl-1-oxopropan-2-yl)-1-(oxolan-3-yl)methanesulfonamide |
| SMILES | CC(NS(=O)(=O)CC1CCOC1)C(=O)N1CCOCC1 |
| InChI | InChI=1S/C12H22N2O5S/c1-10(12(15)14-3-6-18-7-4-14)13-20(16,17)9-11-2-5-19-8-11/h10-11,13H,2-9H2,1H3 |
| InChIKey | NVXDLKIXCLVGFR-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.38 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |