C21H37N5O — CID 127300261
1-(2-tert-butyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl)-3-(2,2,6,6-tetramethylpiperidin-4-yl)urea (PubChem CID 127300261) has the molecular formula C21H37N5O and a molecular weight of 375.56 g/mol. Its IUPAC name is 1-(2-tert-butyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl)-3-(2,2,6,6-tetramethylpiperidin-4-yl)urea.
| Compound Name | 1-(2-tert-butyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl)-3-(2,2,6,6-tetramethylpiperidin-4-yl)urea |
|---|---|
| PubChem CID | 127300261 |
| Molecular Formula | C21H37N5O |
| Molecular Weight | 375.56 g/mol |
| Exact Mass | 375.30 |
| IUPAC Name | 1-(2-tert-butyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl)-3-(2,2,6,6-tetramethylpiperidin-4-yl)urea |
| SMILES | CC1(C)CC(NC(=O)NC2CCc3nc(C(C)(C)C)cn3C2)CC(C)(C)N1 |
| InChI | InChI=1S/C21H37N5O/c1-19(2,3)16-13-26-12-14(8-9-17(26)24-16)22-18(27)23-15-10-20(4,5)25-21(6,7)11-15/h13-15,25H,8-12H2,1-7H3,(H2,22,23,27) |
| InChIKey | KNUHEYOUPXXRDP-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 70.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.56 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |